Carboxylic acids and derivatives
Filtered Search Results
Diethyl maleate, 97%
CAS: 141-05-9 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00009191 InChI Key: IEPRKVQEAMIZSS-WAYWQWQTSA-N Synonym: diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 PubChem CID: 5271566 ChEBI: CHEBI:68508 IUPAC Name: diethyl (Z)-but-2-enedioate SMILES: CCOC(=O)C=CC(=O)OCC
| PubChem CID | 5271566 |
|---|---|
| CAS | 141-05-9 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:68508 |
| MDL Number | MFCD00009191 |
| SMILES | CCOC(=O)C=CC(=O)OCC |
| Synonym | diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 |
| IUPAC Name | diethyl (Z)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-WAYWQWQTSA-N |
Sodium Propionate, FCC, 99-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.06 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M IUPAC Name: sodium propanoate SMILES: [Na+].CCC([O-])=O
| CAS | 137-40-6 |
|---|---|
| Molecular Weight (g/mol) | 96.06 |
| SMILES | [Na+].CCC([O-])=O |
| IUPAC Name | sodium propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
Methyl p-toluate, 99%
CAS: 99-75-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00008441 InChI Key: QSSJZLPUHJDYKF-UHFFFAOYSA-N Synonym: methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate PubChem CID: 7455 IUPAC Name: methyl 4-methylbenzoate SMILES: CC1=CC=C(C=C1)C(=O)OC
| PubChem CID | 7455 |
|---|---|
| CAS | 99-75-2 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00008441 |
| SMILES | CC1=CC=C(C=C1)C(=O)OC |
| Synonym | methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate |
| IUPAC Name | methyl 4-methylbenzoate |
| InChI Key | QSSJZLPUHJDYKF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Phosphoenolpyruvic acid trisodium salt heptahydrate, 98%
CAS: 5541-93-5 Molecular Formula: C3H2Na3O6P Molecular Weight (g/mol): 233.986 MDL Number: MFCD00150737 InChI Key: RJUFBDMHZGRGMA-UHFFFAOYSA-K Synonym: 2-propenoic acid, 2-phosphonooxy-, trisodium salt,trisodium 2-phosphonatooxy prop-2-enoate,unii-78y3q07j1x,phosphoenolpyruvate trisodium salt,2-phosphoenol pyruvate na3salt,2-propenoic acid, 2-phosphonooxy-, sodium salt 1:3,trisodium phosphonatoenolpyruvate,trisodium 2-phosphonatoacrylate,trisodium phosphoenolpyruvate,c3h2o6p.3na PubChem CID: 79673 IUPAC Name: trisodium;2-phosphonatooxyprop-2-enoate SMILES: C=C(C(=O)[O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 79673 |
|---|---|
| CAS | 5541-93-5 |
| Molecular Weight (g/mol) | 233.986 |
| MDL Number | MFCD00150737 |
| SMILES | C=C(C(=O)[O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | 2-propenoic acid, 2-phosphonooxy-, trisodium salt,trisodium 2-phosphonatooxy prop-2-enoate,unii-78y3q07j1x,phosphoenolpyruvate trisodium salt,2-phosphoenol pyruvate na3salt,2-propenoic acid, 2-phosphonooxy-, sodium salt 1:3,trisodium phosphonatoenolpyruvate,trisodium 2-phosphonatoacrylate,trisodium phosphoenolpyruvate,c3h2o6p.3na |
| IUPAC Name | trisodium;2-phosphonatooxyprop-2-enoate |
| InChI Key | RJUFBDMHZGRGMA-UHFFFAOYSA-K |
| Molecular Formula | C3H2Na3O6P |
Ethyl propiolate, 99%
CAS: 623-47-2 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.10 MDL Number: MFCD00009184 InChI Key: FMVJYQGSRWVMQV-UHFFFAOYSA-N Synonym: ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester PubChem CID: 12182 ChEBI: CHEBI:51740 IUPAC Name: ethyl prop-2-ynoate SMILES: CCOC(=O)C#C
| PubChem CID | 12182 |
|---|---|
| CAS | 623-47-2 |
| Molecular Weight (g/mol) | 98.10 |
| ChEBI | CHEBI:51740 |
| MDL Number | MFCD00009184 |
| SMILES | CCOC(=O)C#C |
| Synonym | ethyl propiolate,ethyl acetylenecarboxylate,2-propynoic acid, ethyl ester,propiolic acid ethyl ester,ethyl propynoate,ethoxycarbonyl acetylene,ethyl 2-propynoate,propiolic acid, ethyl ester,unii-w235g5u52s,propynoic acid ethyl ester |
| IUPAC Name | ethyl prop-2-ynoate |
| InChI Key | FMVJYQGSRWVMQV-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
2-Ketoglutaric acid, disodium salt, dihydrate, 99%
CAS: 305-72-6 Molecular Formula: C5H4Na2O5·2H2O Molecular Weight (g/mol): 226.1 MDL Number: MFCD00150702 InChI Key: YBGBJYVHJTVUSL-UHFFFAOYSA-L Synonym: disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate PubChem CID: 31040 IUPAC Name: disodium;2-oxopentanedioate SMILES: C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 31040 |
|---|---|
| CAS | 305-72-6 |
| Molecular Weight (g/mol) | 226.1 |
| MDL Number | MFCD00150702 |
| SMILES | C(CC(=O)[O-])C(=O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium 2-oxoglutarate,unii-flp7p4rm46,disodium 2-oxopentanedioate,flp7p4rm46,pentanedioic acid, 2-oxo-, disodium salt,2-oxoglutaric acid disodium salt,2-ketoglutaric acid disodium salt,alpha-ketoglutaric acid sodium salt,disodium ? ketoglutarate,disodium oxoglurate |
| IUPAC Name | disodium;2-oxopentanedioate |
| InChI Key | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
| Molecular Formula | C5H4Na2O5·2H2O |
Methyl Acetate, 96%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
DL - Lactic Acid Lithium Salt, MP Biomedicals™
CAS: 867-55-0 Molecular Formula: C3H5LiO3 Molecular Weight (g/mol): 96.01 InChI Key: GKQWYZBANWAFMQ-UHFFFAOYNA-M IUPAC Name: lithium(1+) 2-hydroxypropanoate SMILES: [Li+].CC(O)C([O-])=O
| CAS | 867-55-0 |
|---|---|
| Molecular Weight (g/mol) | 96.01 |
| SMILES | [Li+].CC(O)C([O-])=O |
| IUPAC Name | lithium(1+) 2-hydroxypropanoate |
| InChI Key | GKQWYZBANWAFMQ-UHFFFAOYNA-M |
| Molecular Formula | C3H5LiO3 |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
Methyl trans-2-hexenoate, 97%
CAS: 13894-63-8 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00048798 InChI Key: GFUGBRNILVVWIE-AATRIKPKSA-N Synonym: methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 PubChem CID: 5364409 IUPAC Name: methyl (E)-hex-2-enoate SMILES: CCCC=CC(=O)OC
| PubChem CID | 5364409 |
|---|---|
| CAS | 13894-63-8 |
| Molecular Weight (g/mol) | 128.171 |
| MDL Number | MFCD00048798 |
| SMILES | CCCC=CC(=O)OC |
| Synonym | methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 |
| IUPAC Name | methyl (E)-hex-2-enoate |
| InChI Key | GFUGBRNILVVWIE-AATRIKPKSA-N |
| Molecular Formula | C7H12O2 |
Methyl 3,3-dimethoxypropionate, 96%
CAS: 7424-91-1 Molecular Formula: C6H12O4 Molecular Weight (g/mol): 148.158 MDL Number: MFCD00010650 InChI Key: SMCVPMKCDDNUCQ-UHFFFAOYSA-N PubChem CID: 81924 IUPAC Name: methyl 3,3-dimethoxypropanoate SMILES: COC(CC(=O)OC)OC
| PubChem CID | 81924 |
|---|---|
| CAS | 7424-91-1 |
| Molecular Weight (g/mol) | 148.158 |
| MDL Number | MFCD00010650 |
| SMILES | COC(CC(=O)OC)OC |
| IUPAC Name | methyl 3,3-dimethoxypropanoate |
| InChI Key | SMCVPMKCDDNUCQ-UHFFFAOYSA-N |
| Molecular Formula | C6H12O4 |
Copper(II) formate tetrahydrate, 98%
CAS: 5893-61-8 Molecular Formula: C2H10CuO8 Molecular Weight (g/mol): 225.64 MDL Number: MFCD00167128 InChI Key: LSIWWRSSSOYIMS-UHFFFAOYSA-L Synonym: copper ii formate tetrahydrate,cupric formate tetrahydrate,copper diformate tetrahydrate,unii-v7ra28204j,copper 2+ formate tetrahydrate,cupric formate tetrahydrate mi,copper formate cu hcoo 2 tetrahydrate,formic acid copper salt 2:1 tetrahydrate,acmc-209m8c PubChem CID: 6432244 IUPAC Name: copper;diformate;tetrahydrate SMILES: C(=O)[O-].C(=O)[O-].O.O.O.O.[Cu+2]
| PubChem CID | 6432244 |
|---|---|
| CAS | 5893-61-8 |
| Molecular Weight (g/mol) | 225.64 |
| MDL Number | MFCD00167128 |
| SMILES | C(=O)[O-].C(=O)[O-].O.O.O.O.[Cu+2] |
| Synonym | copper ii formate tetrahydrate,cupric formate tetrahydrate,copper diformate tetrahydrate,unii-v7ra28204j,copper 2+ formate tetrahydrate,cupric formate tetrahydrate mi,copper formate cu hcoo 2 tetrahydrate,formic acid copper salt 2:1 tetrahydrate,acmc-209m8c |
| IUPAC Name | copper;diformate;tetrahydrate |
| InChI Key | LSIWWRSSSOYIMS-UHFFFAOYSA-L |
| Molecular Formula | C2H10CuO8 |
Methyl 2-butynoate, 97%
CAS: 23326-27-4 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.1 MDL Number: MFCD00009273 InChI Key: UJQCANQILFWSDJ-UHFFFAOYSA-N Synonym: methyl 2-butynoate,methyl tetrolate,2-butynoic acid, methyl ester,2-butynoic acid methyl ester,tetrolic acid methyl ester,but-2-ynoic acid methyl ester,methyl2-butynoate,methyl 2-butynoate ?,pubchem12783,acmc-1ceil PubChem CID: 141019 IUPAC Name: methyl but-2-ynoate SMILES: CC#CC(=O)OC
| PubChem CID | 141019 |
|---|---|
| CAS | 23326-27-4 |
| Molecular Weight (g/mol) | 98.1 |
| MDL Number | MFCD00009273 |
| SMILES | CC#CC(=O)OC |
| Synonym | methyl 2-butynoate,methyl tetrolate,2-butynoic acid, methyl ester,2-butynoic acid methyl ester,tetrolic acid methyl ester,but-2-ynoic acid methyl ester,methyl2-butynoate,methyl 2-butynoate ?,pubchem12783,acmc-1ceil |
| IUPAC Name | methyl but-2-ynoate |
| InChI Key | UJQCANQILFWSDJ-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Sodium Ascorbate, Powder, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| CAS | 134-03-2 |
|---|---|
| Molecular Weight (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Methyl trans-2-pentenoate, 95%
CAS: 15790-88-2 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00137611 InChI Key: MBAHGFJTIVZLFB-SNAWJCMRSA-N Synonym: methyl 2-pentenoate,methyl trans-2-pentenoate,methyl 2e-pent-2-enoate,2-pentenoic acid, methyl ester,2-pentenoic acid, methyl ester, e,methyl 3-ethylacrylate,methyl 2-transpentenoate,methyl 2-trans-pentenoate,methyl e-2-pentenoate,trans-methyl pent-2-enoate PubChem CID: 5364718 SMILES: CC\C=C\C(=O)OC
| PubChem CID | 5364718 |
|---|---|
| CAS | 15790-88-2 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00137611 |
| SMILES | CC\C=C\C(=O)OC |
| Synonym | methyl 2-pentenoate,methyl trans-2-pentenoate,methyl 2e-pent-2-enoate,2-pentenoic acid, methyl ester,2-pentenoic acid, methyl ester, e,methyl 3-ethylacrylate,methyl 2-transpentenoate,methyl 2-trans-pentenoate,methyl e-2-pentenoate,trans-methyl pent-2-enoate |
| InChI Key | MBAHGFJTIVZLFB-SNAWJCMRSA-N |
| Molecular Formula | C6H10O2 |